Obeticholic Acid 10mM * 1mL in DMSO
Obeticholic Acid is a potent and selective farnesoid X receptor (FXR) agonist with EC50 of 99 nM
| Trivial name | Obeticholic Acid 10mM * 1mL in DMSO |
| Catalog Number | A13866-10mM-D |
| Alternative Name(s) | (3??,5??,6??,7??)-6-ethyl-3,7-dihydroxy-cholan-24-oic acid |
| Molecular Formula | C26H44O4 |
| CAS# | 459789-99-2 |
| SMILES | CC[C@@H]1[C@@H]2C[C@@H](CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3[C@@H]1O)CC[C@@H]4[C@H](C)CCC(=O)O)C)C)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/obeticholic-acid.html |
