BMS303141 10mg
BMS303141 is a potent inhibitor of ATP citrate lyase (ACL). BMS303141 inhibits lipid synthesis in HepG2 cells with an IC50 of 8 ??M, and lowers plasma triglycerides in a murine hyperlipdemia model.
| Trivial name | BMS303141 10mg |
| Catalog Number | A13807-10 |
| Alternative Name(s) | 3,5-Dichloro-2-hydroxy-N-(4-methoxy[1,1'-biphenyl]-3-yl)-benzenesulfonamide |
| Molecular Formula | C19H15Cl2NO4S |
| CAS# | 943962-47-8 |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)NS(=O)(=O)C3=CC(=CC(=C3O)Cl)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bms303141.html |
