UNC569 10mg
UNC569 is a novel small-molecule MER inhibitor with efficacy against acute lymphoblastic leukemia in vitro and in vivo. UNC569 is the first small-molecule Mer inhibitor. UNC569 inhibited Mer activation and downstream signaling through ERK1/2 and AKT.
| Trivial name | UNC569 10mg |
| Catalog Number | A13805-10 |
| Alternative Name(s) | 1-(((1r,4r)-4-aminocyclohexyl)methyl)-N-butyl-3-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
| Molecular Formula | C22H29FN6 |
| CAS# | 1350547-65-7 |
| SMILES | CCCCNC1=NC=C2C(=NN(C2=N1)CC3CCC(CC3)N)C4=CC=C(C=C4)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/unc569.html |