Farampator 50mg
Farampator has been investigated for its effect on AMPA receptors and researched for potential use in the treatment of schizophrenia and Alzheimer’s Disease. It was found to improve short-term memory, but impaired episodic memory.
| Trivial name | Farampator 50mg |
| Catalog Number | A13798-50 |
| Alternative Name(s) | 2,1,3-Benzoxadiazol-5-yl-1-piperidinylmethanone |
| Molecular Formula | C12H13N3O2 |
| CAS# | 211735-76-1 |
| SMILES | C1CCN(CC1)C(=O)C2=CC3=NON=C3C=C2 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/farampator.html |