Hygromycin B 100mg
Hygromycin B is an aminoglycoside antibiotic isolated from Streptomyces hygroscopicus. It acts by inhibiting protein synthesis by inducing the misreading of the m-RNA template in the prokaryote, with the potency to inhibit translation.
| Trivial name | Hygromycin B 100mg |
| Catalog Number | A13796-100 |
| Alternative Name(s) | N/A |
| Molecular Formula | C20H37N3O13 |
| CAS# | 31282-04-9 |
| SMILES | CN[C@H]1C[C@H]([C@@H]([C@H]([C@@H]1O)O[C@H]2[C@@H]3[C@H]([C@H]([C@H](O2)CO)O)OC4(O3)[C@@H]([C@H]([C@H]([C@H](O4)[C@H](CO)N)O)O)O)O)N |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/hygromycin-b.html |
