Atrasentan 10mg
Atrasentan is an experimental drug that is being studied for the treatment of various types of cancer, including non-small cell lung cancer. It is an endothelin receptor antagonist selective for subtype A (ETA).
| Trivial name | Atrasentan 10mg |
| Catalog Number | A13779-10 |
| Alternative Name(s) | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid. |
| Molecular Formula | C29H38N2O6 |
| CAS# | 173937-91-2 |
| SMILES | CCCCN(CCCC)C(=O)CN1C[C@@H]([C@H]([C@@H]1C2=CC=C(C=C2)OC)C(=O)O)C3=CC4=C(C=C3)OCO4 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/atrasentan.html |