BAY-u 3405 50mg
BAY-u 3405 is an approved human medication for the treatment of allergic rhinitis that has documented activity as an antagonist of the thromboxane receptor (TP receptor).
| Trivial name | BAY-u 3405 50mg |
| Catalog Number | A13751-50 |
| Alternative Name(s) | 3R-?[[(4-?fluorophenyl)sulfonyl]amino]-?1,?2,?3,?4-?tetrahydro-?9H-?carbazole-?9-?propanoic acid |
| Molecular Formula | C21H21FN2O4S |
| CAS# | 116649-85-5 |
| SMILES | C1CC2=C(C[C@@H]1NS(=O)(=O)C3=CC=C(C=C3)F)C4=CC=CC=C4N2CCC(=O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/bay-u-3405.html |