Hypothemycin 10mg
Hypothemycin is a resorcylic acid lactone polyketide. It was found to inhibit the proliferation of mouse and human T cells stimulated with anti-CD3 mAb + PMA and of human PBMC stimulated with anti-CD3 mAb alone.
| Trivial name | Hypothemycin 10mg |
| Catalog Number | A13750-10 |
| Alternative Name(s) | (1aR,3S,4S,9S,15bR,Z)-3,4,12-trihydroxy-14-methoxy-9-methyl-3,4,8,9-tetrahydro-1aH-benzo[c]oxireno[2,3-e][1]oxacyclotetradecine-5,11(2H,15bH)-dione |
| Molecular Formula | C19H22O8 |
| CAS# | 76958-67-3 |
| SMILES | CC1C/C=CC(=O)[C@H]2[C@H](O2)C[C@@H]([C@H](C3=CC(=CC(=C3C(=O)O1)O)OC)O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/hypothemycin.html |