Eprosartan mesylate 250mg
Eprosartan (mesylate) is a competitive AT1 receptor antagonist with IC50 values ranging from 1.4 ?€? 3.9 nM and an elimination half-life of five to seven hours.
| Trivial name | Eprosartan mesylate 250mg |
| Catalog Number | A13747-250 |
| Alternative Name(s) | N/A |
| Molecular Formula | C23H24N2O4S.CH3SO3H |
| CAS# | 144143-96-4 |
| SMILES | CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C(CC3=CC=CS3)/C(=O)O.CS(=O)(=O)O |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/eprosartan-mesylate.html |