TC-DAPK6 50mg
TC-DAPK6 is a potent and selective, ATP-competitive inhibitor of death-associated protein kinase 1 (DAPK1) (IC50 values are 69 and 225 nM for DAPK1 and DAPK3 respectively, when assayed with 10 uM ATP).
| Trivial name | TC-DAPK6 50mg |
| Catalog Number | A13742-50 |
| Alternative Name(s) | (4Z)-2-[(E)-2-Phenylethenyl)-4-(3-pyridinylmethylene)-5(4H)-oxazolone |
| Molecular Formula | C17H12N2O2 |
| CAS# | 315694-89-4 |
| SMILES | C1=CC=C(C=C1)/C=C/C2=N/C(=C/C3=CN=CC=C3)/C(=O)O2 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/tc-dapk6.html |
