AR-A 014418 50mg
AR-A 014418 is a selective glycogen synthase kinase 3 (GSK-3) inhibitor (IC50 = 104 nM). Exhibits specificity for GSK-3 over cdk2 and cdk5 (IC50 values are > 100 ??M) and over 26 other kinases. Inhibits ??-amyloid-mediated neurodegeneration in hippocampal slices.
| Trivial name | AR-A 014418 50mg |
| Catalog Number | A13728-50 |
| Alternative Name(s) | N-[(4-Methoxyphenyl)methyl]-N'-(5-nitro-2-thiazolyl)urea |
| Molecular Formula | C12H12N4O4S |
| CAS# | 487021-52-3 |
| SMILES | COC1=CC=C(C=C1)CNC(=O)NC2=NC=C(S2)[N+](=O)[O-] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/ar-a-014418.html |
