Icotinib Hydrochloride 50mg
Icotinib hydrochloride is a potent and specific epidermal growth factor receptor (EGFR) tyrosine kinase inhibitor (TKI) with an IC(50) of 5 nM, including it’s mutants of EGFR(L858R), EGFR(L861Q), EGFR(T790M) and EGFR(T790M, L858R).
| Trivial name | Icotinib Hydrochloride 50mg |
| Catalog Number | A13718-50 |
| Alternative Name(s) | N-(3-Ethynylphenyl)-7,8,10,11,13,14-hexahydro-[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazolin-4-amine hydrochloride |
| Molecular Formula | C22H22ClN3O4 |
| CAS# | 1204313-51-8 |
| SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC4=C(C=C32)OCCOCCOCCO4.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/icotinib-hydrochloride.html |
