Bromocriptin mesylate 500mg
Bromocriptine mesylate is a potent dopamine receptor agonist that binds the D2 receptor with highest affinity (Ki = 2.5 nM).1,2 As a result, it has found applications in combination therapy for Parkinsonism.
| Trivial name | Bromocriptin mesylate 500mg |
| Catalog Number | A13705-500 |
| Alternative Name(s) | (5a)-2-bromo-12'-hydroxy-2'-(1-methylethyl)-5'-(2-methylpropyl)-errgotaman-3',6',18-trione, monomethanesulfonate |
| Molecular Formula | C32H40BrN5O5CH3SO3H |
| CAS# | 22260-51-1 |
| SMILES | CC(C)C[C@H]1C(=O)N2CCC[C@H]2[C@]3(N1C(=O)[C@](O3)(C(C)C)NC(=O)[C@H]4CN([C@@H]5CC6=C(NC7=CC=CC(=C67)C5=C4)Br)C)O.CS(=O)(=O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/bromocriptin-mesylate.html |