Xanomeline oxalate 5mg
Xanomeline oxalate is a potent agonist of muscarinic acetylcholine receptors (EC50 values are 0.3, 92.5, 5, 52, and 42 nM for M1, M2, M3, M4, and M5, respectively).
| Trivial name | Xanomeline oxalate 5mg |
| Catalog Number | A13685-5 |
| Alternative Name(s) | 3-[4-(hexyloxy)-1,2,5-thiadiazol-3-yl]-1,2,5,6-tetrahydro-1-methyl-pyridine, ethanedioate |
| Molecular Formula | C14H23N3OSC2H2O4 |
| CAS# | 141064-23-5 |
| SMILES | CCCCCCOC1=NSN=C1C2=CCCN(C2)C.C(=O)(C(=O)O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/xanomeline-oxalate.html |
