AZD-9291 5mg
AZD-9291 is a third-generation EGFR inhibitor, showed promise in preclinical studies and provides hope for patients with advanced lung cancers that have become resistant to existing EGFR inhibitors.
| Trivial name | AZD-9291 5mg |
| Catalog Number | A13681-5 |
| Alternative Name(s) | N-(2-((2-(dimethylamino)ethyl)(methyl)amino)-4-methoxy-5-((4-(1-methyl-1H-indol-3-yl)pyrimidin-2-yl)amino)phenyl)acrylamide |
| Molecular Formula | C28H33N7O2 |
| CAS# | 1421373-65-0 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(C=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OC |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/azd-9291.html |