EGFR Inhibitor 5mg
EGFR inhibitor is a cell permeable, 4,6-disubstituted pyrimidine compound that selectively inhibits the EGFR kinase with an IC50 value of 21 nM in vitro and blocks receptor autophosphorylation in cells.
| Trivial name | EGFR Inhibitor 5mg |
| Catalog Number | A13673-5 |
| Alternative Name(s) | N-[3-[[6-[[3-(trifluoromethyl)phenyl]amino]-4-pyrimidinyl]amino]phenyl]-cyclopropanecarboxamide |
| Molecular Formula | C21H18F3N5O |
| CAS# | 879127-07-8 |
| SMILES | C1CC1C(=O)NC2=CC=CC(=C2)NC3=NC=NC(=C3)NC4=CC=CC(=C4)C(F)(F)F |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/egfr-inhibitor.html |
