2-HG (sodium salt) 500mg
a-Hydroxyglutaric acid (2-HG) is an a-hydroxy acid. It is normally metabolized to 2-oxoglutarate by D- and L-2-hydroxyglutarate dehydrogenases, and mutations in these enzymes cause 2-hydroxyglutaric aciduria, a neurometabolic disorder.
| Trivial name | 2-HG (sodium salt) 500mg |
| Catalog Number | A13632-500 |
| Alternative Name(s) | 2-hydroxypentanedioic acid |
| Molecular Formula | C5H6O52Na |
| CAS# | 40951-21-1 |
| SMILES | C(CC(=O)[O-])C(C(=O)[O-])O.[Na+].[Na+] |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/2-hg-sodium-salt.html |
