Celiprolol HCl 25mg
Celiprolol HCl is a b1 adrenergic receptor antagonist and a b2 adrenergic receptor partial agonist that has been shown to relax human arteries and veins with ED50 values of 40-50 M in vitro.
| Trivial name | Celiprolol HCl 25mg |
| Catalog Number | A13623-25 |
| Alternative Name(s) | N'-[3-acetyl-4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-N,N-diethyl-urea, monohydrochloride |
| Molecular Formula | C20H34ClN3O4 |
| CAS# | 57470-78-7 |
| SMILES | CCN(CC)C(=O)NC1=CC(=C(C=C1)OCC(CNC(C)(C)C)O)C(=O)C.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/celiprolol-hcl.html |