10-DEBC HCl 25mg
10-DEBC HCl is a selective inhibitor of Akt/PKB. It inhibits IGF-1-stimulated phosphorylation and activation of Akt (complete inhibition at 2.5 ??M), suppressing downstream activation of mTOR, p70 S6 kinase and S6 ribosomal protein.
| Trivial name | 10-DEBC HCl 25mg |
| Catalog Number | A13590-25 |
| Alternative Name(s) | 2-chloro-N,N-diethyl-10H-phenoxazine-10-butanamine, monohydrochloride |
| Molecular Formula | C20H25ClN2OHCl |
| CAS# | 925681-41-0 |
| SMILES | CCN(CC)CCCCN1C2=CC=CC=C2OC3=C1C=C(C=C3)Cl.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/10-debc-hcl.html |