AT101 100mg
AT101, the R-(-) enantiomer of Gossypol acetic acid, binds with Bcl-2, Bcl-xL and Mcl-1 with Ki of 0.32 ??M, 0.48 ??M and 0.18 ??M; does not inhibit BIR3 domain and BID
| Trivial name | AT101 100mg |
| Catalog Number | A13578-100 |
| Alternative Name(s) | R-(-)-gossypol acetic acid |
| Molecular Formula | C30H30O8.C2H4O2 |
| CAS# | 866541-93-7 |
| SMILES | CC1=C(C(=C2C(=C1)C(=C(C(=C2C=O)O)O)C(C)C)O)C3=C(C=C4C(=C3O)C(=C(C(=C4C(C)C)O)O)C=O)C.CC(=O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/at101.html |
