NRC-AN-019 25mg
NRC-AN-019 is an orally administered tyrosine kinase inhibitor (TKI) of the Bcr-Abl protein-tyrosine kinase. NRC-AN-019 is more effective in inhibiting angiogenic potential and proliferation of both MDAMB231 and HTB20/BT474 cells.
| Trivial name | NRC-AN-019 25mg |
| Catalog Number | A13562-25 |
| Alternative Name(s) | N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-3,5-bis(trifluoromethyl)- |
| Molecular Formula | C25H17F6N5O |
| CAS# | 879507-25-2 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)NC3=NC=CC(=N3)C4=CN=CC=C4 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/nrc-an-019.html |