Icilin 25mg
Icilin is a cooling agent that activates the novel cold receptors TRPM8 (CMR1) and TRPA1 (ANKTM1/TRPN1), members of the TRP ion channel family. Induces currents in CMR1-expressing HEK 293 cells (EC50 = 0.36 ??M)
Trivial name | Icilin 25mg |
Catalog Number | A13560-25 |
Alternative Name(s) | 3,4-Dihydro-3-(2-hydroxyphenyl)-6-(3-nitrophenyl)-(1H)-pyrimidin-2-one |
Molecular Formula | C16H13N3O4 |
CAS# | 36945-98-9 |
SMILES | C1C=C(NC(=O)N1C2=CC=CC=C2O)C3=CC(=CC=C3)[N+](=O)[O-] |
Size | 25mg |
Supplier Page | http://www.adooq.com/icilin.html |