JI-101 5mg
JI-101 is an orally active inhibitor of vascular endothelial growth factor receptor 2 (VEGFR2), platelet-derived growth factor receptor beta (PDGFRb), and the ephrin B4 receptor B4 (EphB4) with potential antiangiogenic and antineoplastic activities.
| Trivial name | JI-101 5mg |
| Catalog Number | A13545-5 |
| Alternative Name(s) | 1-(1-((2-aminopyridin-4-yl)methyl)-1H-indol-4-yl)-3-(5-bromo-2-methoxyphenyl)urea. |
| Molecular Formula | C22H20BrN5O2 |
| CAS# | 900573-88-8 |
| SMILES | COC1=C(C=C(C=C1)Br)NC(=O)NC2=CC=CC3=C2C=CN3CC4=CC(=NC=C4)N |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/ji-101.html |