NSC 663284 10mg
NSC 663284 is a potent, cell-permeable, and irreversible inhibitor of all Cdc25 isoforms, with preference for Cdc25A (IC50 = 29, 95, and 89 nM for Cdc25A, Cdc25B2, and Cdc25C, respectively).
| Trivial name | NSC 663284 10mg |
| Catalog Number | A13524-10 |
| Alternative Name(s) | 6-chloro-7-[[2-(4-morpholinyl)ethyl]amino]-5,8-quinolinedione |
| Molecular Formula | C15H16ClN3O3 |
| CAS# | 383907-43-5 |
| SMILES | C1COCCN1CCNC2=C(C(=O)C3=C(C2=O)N=CC=C3)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/nsc-663284.html |