Ro 31-8220 10mg
Ro 31-8220 is a PKC-inhibitor, which inhibits stimulated fluid pinocytosis of human PMNs induced by the PKC-activators phorbol myristate acetate (PMA, IC50 = 1.35 x 10(-6) M) or diacylglycerols (OAG, diC8) by 95%.
| Trivial name | Ro 31-8220 10mg |
| Catalog Number | A13514-10 |
| Alternative Name(s) | 3-[3-[2,5-dihydro-4-(1-methyl-1H-indol-3-yl)-2,5-dioxo-1H-pyrrol-3-yl]-1H-indol-1-yl]propyl ester-methanesulfonate, carbamimidothioic acid |
| Molecular Formula | C25H23N5O2SCH3SO3H |
| CAS# | 138489-18-6 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)CCCSC(=N)N.CS(=O)(=O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/ro-31-8220.html |
