Golotimod 25mg
Golotimod is an orally bioavailable synthetic peptide containing the amino acids D-glutamine and L-tryptophan connected by a gamma-glutamyl linkage with potential immunostimulating, antimicrobial and antineoplastic activities.
Trivial name | Golotimod 25mg |
Catalog Number | A13472-25 |
Alternative Name(s) | (R)-2-amino-5-(((S)-1-carboxy-2-(1H-indol-3-yl)ethyl)amino)-5-oxopentanoic acid |
Molecular Formula | C16H19N3O5 |
CAS# | 229305-39-9 |
SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)CC[C@H](C(=O)O)N |
Size | 25mg |
Supplier Page | http://www.adooq.com/golotimod.html |