Anidulafungin 10mM * 1mL in DMSO
Anidulafungin is a semi-synthetic cyclic lipopeptide belonging to the echinocandin class that was reported in 1995 and commercially developed by Eli Lilly. Anidulafungin inhibits the synthesis of ??-(1,3)-D-glucan, an essential component of the cell wall of susceptible fungi and is extensively referenced in the literature with over 400 citations.
| Trivial name | Anidulafungin 10mM * 1mL in DMSO |
| Catalog Number | A13436-10mM-D |
| Alternative Name(s) | 1-[(4R,5R)-4,5-dihydroxy-N2-[[4''-(pentyloxy)[1,1'?',1''-terphenyl]-4-yl]carbonyl]-L-ornithine]-echinocandin B |
| Molecular Formula | C58H73N7O17 |
| CAS# | 166663-25-8 |
| SMILES | CCCCCOC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)N[C@H]4C[C@H]([C@H](NC(=O)[C@@H]5[C@H]([C@H](CN5C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]6C[C@H](CN6C(=O)[C@@H](NC4=O)[C@@H](C)O)O)[C@@H]([C@H](C7=CC=C(C=C7)O)O)O)[C@@H](C)O)C)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/anidulafungin.html |
