(-)-MK 801 maleate 50mg
(-)-MK 801 maleate acts as a potent, selective, and non-competitive NMDA receptor antagonist. It acts by binding to a site located within the NMDA associated ion channel.
| Trivial name | (-)-MK 801 maleate 50mg |
| Catalog Number | A13435-50 |
| Alternative Name(s) | (5R,10S)-(-)-5-Methyl-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine maleate |
| Molecular Formula | C16H15NC4H4O4 |
| CAS# | 121917-57-5 |
| SMILES | C[C@]12C3=CC=CC=C3C[C@H](N1)C4=CC=CC=C24.C(=C/C(=O)O)C(=O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/mk-801-maleate.html |