GDC0994 10mM * 1mL in DMSO
GDC-0994 is a potent and selective Erk1/2 inhibitor. GDC-0994 inhibits both ERK phosphorylation and activation of ERK-mediated signal transduction pathways.
| Trivial name | GDC0994 10mM * 1mL in DMSO |
| Catalog Number | A13420-10mM-D |
| Alternative Name(s) | (S)-1-(1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl)-4-(2-(1-methyl-1H-pyrazol-5-ylamino)pyrimidin-4-yl)pyridin-2(1H)-one |
| Molecular Formula | C21H18ClFN6O2 |
| CAS# | 1453848-26-4 |
| SMILES | CN1C(=CC=N1)NC2=NC=CC(=N2)C3=CC(=O)N(C=C3)[C@H](CO)C4=CC(=C(C=C4)Cl)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gdc0994.html |
