NAN-190 hydrobromide 100mg
NAN-190 is a drug and research chemical widely used in scientific studies. It was previously believed to act as a selective 5-HT1A receptor antagonist, but a subsequent discovery showed that it also potently blocks the α2-adrenergic receptor.
| Trivial name | NAN-190 hydrobromide 100mg |
| Catalog Number | A13417-100 |
| Alternative Name(s) | 1-(2-Methoxyphenyl)-4-(phthalimidobutyl)piperazine hydrobromide |
| Molecular Formula | C23H28BrN3O3 |
| CAS# | 115388-32-4 |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCCN3C(=O)C4=CC=CC=C4C3=O.Br |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/nan-190-hydrobromide.html |
