HEAT hydrochloride 25mg
HEAT hydrochloride is a very selective ??1-AR adrenoceptor antagonist, precursor of the 3-[125I]-derivative. Adrenoreceptors (AR) or adrenergic receptors are G-protein coupled receptors involved in a variety of sympathetic nervous system processes.
| Trivial name | HEAT hydrochloride 25mg |
| Catalog Number | A13408-25 |
| Alternative Name(s) | 3,4-Dihydro-2-[[[2-(4-hydroxyphenyl)ethyl]amino]methyl]-1(2H)-naphthalenone hydrochloride |
| Molecular Formula | C19H22ClNO2 |
| CAS# | 30007-39-7 |
| SMILES | C1CC2=CC=CC=C2C(=O)C1CNCCC3=CC=C(C=C3)O.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/heat-hydrochloride.html |
