Flufenamic acid 1000mg
Flufenamic acid is a nonsteroidal anti-inflammatory drug (NSAID). Inhibits calcium-activated chloride channels (CaCCs). Also increases currents through TRPC6 channels and inhibits currents through TRPC3 and TRPC7 channels.
| Trivial name | Flufenamic acid 1000mg |
| Catalog Number | A13333-1000 |
| Alternative Name(s) | 2-[[3-(Trifluoromethyl)phenyl]amino?]benzoic acid |
| Molecular Formula | C14H10F3NO2 |
| CAS# | 530-78-9 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/flufenamic-acid.html |