BAY57-1293 10mM * 1mL in DMSO
BAY 57-1293 is a potent helicase primase inhibitor. BAY 57-1293 inhibits replication of herpes simplex virus (HSV) type 1 and type 2 in the nanomolar range in vitro by abrogating the enzymatic activity of the viral primase-helicase complex.
| Trivial name | BAY57-1293 10mM * 1mL in DMSO |
| Catalog Number | A13324-10mM-D |
| Alternative Name(s) | N-methyl-N-(4-methyl-5-sulfamoylthiazol-2-yl)-2-(4-(pyridin-2-yl)phenyl)acetamide |
| Molecular Formula | C18H18N4O3S2 |
| CAS# | 348086-71-5 |
| SMILES | CC1=C(SC(=N1)N(C)C(=O)CC2=CC=C(C=C2)C3=CC=CC=N3)S(=O)(=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bay57-1293.html |