GSK-650394 10mM * 1mL in DMSO
GSK 650394 is a glucocorticoid- and serum-regulated kinase 1 (SGK1) inhibitor which displays antiproliferative properties against the LNCaP prostate carcinoma cell line.
| Trivial name | GSK-650394 10mM * 1mL in DMSO |
| Catalog Number | A13309-10mM-D |
| Alternative Name(s) | 2-Cyclopentyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl-benzoic acid |
| Molecular Formula | C25H22N2O2 |
| CAS# | 890842-28-1 |
| SMILES | C1CCC(C1)C2=C(C=CC(=C2)C3=CNC4=NC=C(C=C34)C5=CC=CC=C5)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gsk-650394.html |