Apramycin Sulfate 10mM * 1mL in DMSO
Apramycin Sulfate is a broad spectrum aminocyclitol antibiotic and component of the Nebramycin complex, produced by a strain of Streptomyces tenebrarius
Trivial name | Apramycin Sulfate 10mM * 1mL in DMSO |
Catalog Number | A13243-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C21H41N5O11.xH2O4S |
CAS# | 65710-07-8 |
SMILES | CNC1C(C2C(CC(C(O2)OC3C(CC(C(C3O)O)N)N)N)OC1OC4C(C(C(C(O4)CO)N)O)O)O.OS(=O)(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/apramycin-sulfate.html |