LDK-378 25mg
LDK378 is a highly selective, orally bioavailable and ATP-competitive small molecule inhibitor of ALK (Anaplastic Lymphoma Kinase), a receptor tyrosine kinase considered to be an important lung cancer drug target.
| Trivial name | LDK-378 25mg |
| Catalog Number | A13238-25 |
| Alternative Name(s) | 5-chloro-N2-(2-isopropoxy-5-methyl-4-(piperidin-4-yl)phenyl)-N4-(2-(isopropylsulfonyl)phenyl)pyrimidine-2,4-diamine |
| Molecular Formula | C28H36ClN5O3S |
| CAS# | 1032900-25-6 |
| SMILES | CC1=CC(=C(C=C1C2CCNCC2)OC(C)C)NC3=NC=C(C(=N3)NC4=CC=CC=C4S(=O)(=O)C(C)C)Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/ldk-378.html |