MPEP HCl 100mg
MPEP is a potent, highly selective non-competitive antagonist at the mGlu5a receptor subtype (IC50 = 36 nM) while having no agonist or antagonist activities at the mGlu1b receptor at concentrations up to 30 uM.
| Trivial name | MPEP HCl 100mg |
| Catalog Number | A13236-100 |
| Alternative Name(s) | 2-?methyl-?6-?(2-?phenylethynyl)-?pyridine,? monohydrochloride |
| Molecular Formula | C14H11N.HCl |
| CAS# | 219911-35-0 |
| SMILES | CC1=CC=CC(=N1)C#CC2=CC=CC=C2.Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/mpep-hcl.html |
