IU1 10mM * 1mL in DMSO
IU1 is a selective inhibitor of Usp14. It inhibits the catalytic activity of proteasome-associated Usp14 in vitro (IC50 < 4 uM).
| Trivial name | IU1 10mM * 1mL in DMSO |
| Catalog Number | A13209-10mM-D |
| Alternative Name(s) | 1-[1-(4-Fluoro-phenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-pyrrolidin-1-yl-ethanone |
| Molecular Formula | C18H21FN2O |
| CAS# | 314245-33-5 |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)F)C)C(=O)CN3CCCC3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/iu1.html |
