UNC0646 50mg
UNC0646 is a potent and selective inhibitor of the homologous protein lysine methyltransferases, G9a and GLP (IC50 values are 6 nM and 15 nM for G9a and GLP, respectively).
| Trivial name | UNC0646 50mg |
| Catalog Number | A13194-50 |
| Alternative Name(s) | N-(1-Cyclohexyl-4-piperidinyl)-2-[h?exahydro-4-(1-methylethyl)-1H-1,4-diazepin-1-yl]-6?-methoxy-7-[3-(1-piperidinyl)propoxy]-4-quinazolin?amine |
| Molecular Formula | C36H59N7O2 |
| CAS# | 1320288-17-2 |
| SMILES | CC(C)N1CCCN(CC1)C2=NC3=CC(=C(C=C3C(=N2)NC4CCN(CC4)C5CCCCC5)OC)OCCCN6CCCCC6 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/unc0646.html |
