CGK 733 10mM * 1mL in DMSO
CGK733 is a selective inhibitor of ATR and ATM kinases. Induces cell death in prematurely senescent breast cancer cells.
| Trivial name | CGK 733 10mM * 1mL in DMSO |
| Catalog Number | A13191-10mM-D |
| Alternative Name(s) | ??-Phenyl-N-[2,2,2-trichloro-1-[[[(4-?fluoro-3-nitrophenyl)amino]thioxomethyl]amino]ethy?l]benzeneacetamide |
| Molecular Formula | C23H18Cl3FN4O3S |
| CAS# | 905973-89-9 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC3=CC(=C(C=C3)F)[N+](=O)[O-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cgk-733.html |
