RI-1 5mg
RI-1 is a small molecule that inhibits the central recombination protein RAD51. RI-1 specifically reduces gene conversion in human cells while stimulating single strand annealing. RI-1 binds covalently to the surface of RAD51 protein at cysteine 319 that likely destabilizes an interface used by RAD51 monomers to oligomerize into filaments on DNA.
| Trivial name | RI-1 5mg |
| Catalog Number | A13187-5 |
| Alternative Name(s) | 3-Chloro-1-(3,4-dichlorophenyl)-4-(4-morpholinyl)-1H-pyrrole-2,5-dione |
| Molecular Formula | C14H11Cl3N2O3 |
| CAS# | 415713-60-9 |
| SMILES | C1COCCN1C2=C(C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)Cl)Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/ri-1.html |