AZD1981 10mM * 1mL in DMSO
AZD1981, as a potent antagonist in a disease relevant cell system, inhibits DK-PGD2-induced CD11b expression in human eosinophils with IC50 of 10 nM.
| Trivial name | AZD1981 10mM * 1mL in DMSO |
| Catalog Number | A13186-10mM-D |
| Alternative Name(s) | 7-Methyl-5-[(3-piperazin-1-ylMethyl)-1,2,4-oxadiazol-5-yl-]-2-[4-(trifluoroMethoxy)benzyl]-2,3-dihydro-1H-isoindol-1-one Methanesulphonat |
| Molecular Formula | C19H17ClN2O3S |
| CAS# | 802904-66-1 |
| SMILES | CC1=C(C2=C(N1CC(=O)O)C=CC=C2NC(=O)C)SC3=CC=C(C=C3)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azd1981.html |
