UNC-1999 10mM * 1mL in DMSO
UNC1999 is the first orally bioavailable inhibitor that has high in vitro potency for wildtype and mutant EZH2 as well as EZH1.
| Trivial name | UNC-1999 10mM * 1mL in DMSO |
| Catalog Number | A13166-10mM-D |
| Alternative Name(s) | 1-isopropyl-6-(6-(4-isopropylpiperazin-1-yl)pyridin-3-yl)-N-((6-methyl-2-oxo-4-propyl-1,2-dihydropyridin-3-yl)methyl)-1H-indazole-4-carboxamide |
| Molecular Formula | C33H43N7O2 |
| CAS# | 1431612-23-5 |
| SMILES | CCCC1=C(C(=O)NC(=C1)C)CNC(=O)C2=C3C=NN(C3=CC(=C2)C4=CN=C(C=C4)N5CCN(CC5)C(C)C)C(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/unc-1999.html |
