LY 379268 50mg
LY 379268 is a highly selective group II mGlu receptor agonist (EC50 values are 2.69 and 4.48 nM for hmGlu2 and hmGlu3 respectively) that displays > 80-fold selectivity over group I and group III receptors.
| Trivial name | LY 379268 50mg |
| Catalog Number | A13123-50 |
| Alternative Name(s) | (1R,4R,5S,6R)-4-Amino-2-oxabicyclo[?3.1.0]hexane-4,6-dicarboxylic acid |
| Molecular Formula | C7H9NO5 |
| CAS# | 191471-52-0 |
| SMILES | C1[C@]([C@@H]2[C@H]([C@@H]2O1)C(=O)O)(C(=O)O)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/ly-379268.html |