Triphendiol (NV-196) 25mg
Triphendiol (NV-196) is a synthetic isoflavene. Triphendiol (NV-196) is another investigational drug in the Marshall Edwards, Inc., oncology drug pipeline. Triphendiol is broadly cytostatic and cytotoxic against most forms of human cancer cells in vitro, and has been shown to cause cell cycle arrest (or stop cells increasing in number) and to induce apoptosis (or initiate programmed cell death) in various cancer cell lines.
| Trivial name | Triphendiol (NV-196) 25mg |
| Catalog Number | A13100-25 |
| Alternative Name(s) | (3S,4R)-3-(4-hydroxyphenyl)-4-(4-methoxyphenyl)chroman-7-ol |
| Molecular Formula | C22H20O4 |
| CAS# | 1213777-80-0 |
| SMILES | COC1=CC=C(C=C1)[C@@H]2[C@@H](COC3=C2C=CC(=C3)O)C4=CC=C(C=C4)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/triphendiol-nv-196.html |
