SANT-1 10mM * 1mL in DMSO
SANT-1 is a potent, cell-permeable inhibitor of Sonic hedgehog (Shh) signaling; high affinity antagonist of smoothened activity (KD = 1.2 nM). Inhibits smoothened agonist effects with an IC50 of 20 nM (in Shh-LIGHT2 cells).
| Trivial name | SANT-1 10mM * 1mL in DMSO |
| Catalog Number | A13095-10mM-D |
| Alternative Name(s) | N-[(3,5-dimethyl-1-phenyl-1H-pyrazo?l-4-yl)methylene]-4-(phenylmethyl)-1-piperazinamin?e |
| Molecular Formula | C23H27N5 |
| CAS# | 304909-07-7 |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)/C=N/N3CCN(CC3)CC4=CC=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sant-1.html |