N6022 10mM * 1mL in DMSO
N6022 is a potent, specific, and fully reversible inhibitor of S-nitrosoglutathione reductase (GSNOR) with an IC50 of 8 nM and a Ki of 2.5 nM.
| Trivial name | N6022 10mM * 1mL in DMSO |
| Catalog Number | A13046-10mM-D |
| Alternative Name(s) | 3-(5-(4-(1H-imidazol-1-yl)phenyl)-1-(4-carbamoyl-2-methylphenyl)-1H-pyrrol-2-yl)propanoic acid |
| Molecular Formula | C24H22N4O3 |
| CAS# | 1208315-24-5 |
| SMILES | CC1=C(C=CC(=C1)C(=O)N)N2C(=CC=C2C3=CC=C(C=C3)N4C=CN=C4)CCC(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/n6022.html |
