CO-1686 10mM * 1mL in DMSO
CO-1686 is a novel, oral, targeted covalent (irreversible) inhibitor of the cancer-causing mutant forms of epidermal growth factor receptor (EGFR) currently being studied for the treatment of non-small cell lung cancer (NSCLC).
Trivial name | CO-1686 10mM * 1mL in DMSO |
Catalog Number | A13028-10mM-D |
Alternative Name(s) | N-(3-((2-((4-(4-acetylpiperazin-1-yl)-2-methoxyphenyl)amino)-5-(trifluoromethyl)pyrimidin-4-yl)amino)phenyl)acrylamide |
Molecular Formula | C27H28F3N7O3 |
CAS# | 1374640-70-6 |
SMILES | CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/co-1686.html |