EPZ004777 10mM * 1mL in DMSO
EPZ004777 is a potent, selective inhibitor of DOT1L. EPZ004777 selectively inhibits cellular H3K79 methylation and inhibits expression of key MLL fusion target genes.
| Trivial name | EPZ004777 10mM * 1mL in DMSO |
| Catalog Number | A12983-10mM-D |
| Alternative Name(s) | 1-(3-((((2R,3S,4R,5R)-5-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)(isopropyl)amino)propyl)-3-(4-(tert-butyl)phenyl)urea |
| Molecular Formula | C28H41N7O4 |
| CAS# | 1338466-77-5 |
| SMILES | CC(C)N(CCCNC(=O)NC1=CC=C(C=C1)C(C)(C)C)C[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=CC4=C3N=CN=C4N)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/epz004777.html |
