StemRegenin 1 (SR1) 10mM * 1mL in DMSO
StemRegenin 1 (SR1) is a cell-permeable purine derivative that acts as an antagonist of aryl hydrocarbon receptor and promotes the self-renewal of hematopoietic stem cells (HSCs).
| Trivial name | StemRegenin 1 (SR1) 10mM * 1mL in DMSO |
| Catalog Number | A12945-10mM-D |
| Alternative Name(s) | 4-(2-((2-Benzo[b]thiphen-3-yl)-9-isopropyl-9H-purin-6-yl)amino)ethyl)phenol hydrochloride |
| Molecular Formula | C24H23N5OS?HCl |
| CAS# | 1227633-49-9 |
| SMILES | CC(C)N1C=NC2=C1N=C(N=C2NCCC3=CC=C(C=C3)O)C4=CSC5=CC=CC=C54 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/stemregenin-1-sr1.html |